C18H24BN5O3 — CID 163955786
CID 163955786 (PubChem CID 163955786) has the molecular formula C18H24BN5O3 and a molecular weight of 369.23 g/mol.
| Compound Name | CID 163955786 |
|---|---|
| PubChem CID | 163955786 |
| Molecular Formula | C18H24BN5O3 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | — |
| SMILES | [B]C1=COC(N2CCC(=NOCc3ccn(C4CCCCO4)n3)CC2)N=C1 |
| InChI | InChI=1S/C18H24BN5O3/c19-14-11-20-18(26-12-14)23-7-4-15(5-8-23)22-27-13-16-6-9-24(21-16)17-3-1-2-10-25-17/h6,9,11-12,17-18H,1-5,7-8,10,13H2 |
| InChIKey | OZQCKHOBPZZSJL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|