C19H29BrN4O3 — CID 126562083
1-(5-bromopyrimidin-2-yl)-N-[3-methyl-3-(oxan-2-yloxy)butoxy]piperidin-4-imine (PubChem CID 126562083) has the molecular formula C19H29BrN4O3 and a molecular weight of 441.37 g/mol. Its IUPAC name is 1-(5-bromopyrimidin-2-yl)-N-[3-methyl-3-(oxan-2-yloxy)butoxy]piperidin-4-imine.
| Compound Name | 1-(5-bromopyrimidin-2-yl)-N-[3-methyl-3-(oxan-2-yloxy)butoxy]piperidin-4-imine |
|---|---|
| PubChem CID | 126562083 |
| Molecular Formula | C19H29BrN4O3 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-(5-bromopyrimidin-2-yl)-N-[3-methyl-3-(oxan-2-yloxy)butoxy]piperidin-4-imine |
| SMILES | CC(C)(CCON=C1CCN(c2ncc(Br)cn2)CC1)OC1CCCCO1 |
| InChI | InChI=1S/C19H29BrN4O3/c1-19(2,27-17-5-3-4-11-25-17)8-12-26-23-16-6-9-24(10-7-16)18-21-13-15(20)14-22-18/h13-14,17H,3-12H2,1-2H3 |
| InChIKey | CPSACEXWVZIHPJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|