C19H18BrN5O3 — CID 126562173
2-[2-[[1-(5-bromopyrimidin-2-yl)piperidin-4-ylidene]amino]oxyethyl]isoindole-1,3-dione (PubChem CID 126562173) has the molecular formula C19H18BrN5O3 and a molecular weight of 444.29 g/mol. Its IUPAC name is 2-[2-[[1-(5-bromopyrimidin-2-yl)piperidin-4-ylidene]amino]oxyethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[1-(5-bromopyrimidin-2-yl)piperidin-4-ylidene]amino]oxyethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126562173 |
| Molecular Formula | C19H18BrN5O3 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-[2-[[1-(5-bromopyrimidin-2-yl)piperidin-4-ylidene]amino]oxyethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCON=C1CCN(c2ncc(Br)cn2)CC1 |
| InChI | InChI=1S/C19H18BrN5O3/c20-13-11-21-19(22-12-13)24-7-5-14(6-8-24)23-28-10-9-25-17(26)15-3-1-2-4-16(15)18(25)27/h1-4,11-12H,5-10H2 |
| InChIKey | FPINHIJNOKRGEN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|