C22H35FN4S — CID 134591722
[2-[4-(5-cyclohexyl-4,4-dimethylpentyl)iminopiperidin-1-yl]pyrimidin-5-yl] thiohypofluorite (PubChem CID 134591722) has the molecular formula C22H35FN4S and a molecular weight of 406.62 g/mol. Its IUPAC name is [2-[4-(5-cyclohexyl-4,4-dimethylpentyl)iminopiperidin-1-yl]pyrimidin-5-yl] thiohypofluorite.
| Compound Name | [2-[4-(5-cyclohexyl-4,4-dimethylpentyl)iminopiperidin-1-yl]pyrimidin-5-yl] thiohypofluorite |
|---|---|
| PubChem CID | 134591722 |
| Molecular Formula | C22H35FN4S |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | [2-[4-(5-cyclohexyl-4,4-dimethylpentyl)iminopiperidin-1-yl]pyrimidin-5-yl] thiohypofluorite |
| SMILES | CC(C)(CCCN=C1CCN(c2ncc(SF)cn2)CC1)CC1CCCCC1 |
| InChI | InChI=1S/C22H35FN4S/c1-22(2,15-18-7-4-3-5-8-18)11-6-12-24-19-9-13-27(14-10-19)21-25-16-20(28-23)17-26-21/h16-18H,3-15H2,1-2H3 |
| InChIKey | QIEXUEQVYPIISV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|