C33H49FN4 — CID 134591466
N-[3-(2-cyclohexylethyl)-7,7-dimethyloctyl]-1-[5-(3-ethyl-2-fluorophenyl)pyrimidin-2-yl]azetidin-3-imine (PubChem CID 134591466) has the molecular formula C33H49FN4 and a molecular weight of 520.78 g/mol. Its IUPAC name is N-[3-(2-cyclohexylethyl)-7,7-dimethyloctyl]-1-[5-(3-ethyl-2-fluorophenyl)pyrimidin-2-yl]azetidin-3-imine.
| Compound Name | N-[3-(2-cyclohexylethyl)-7,7-dimethyloctyl]-1-[5-(3-ethyl-2-fluorophenyl)pyrimidin-2-yl]azetidin-3-imine |
|---|---|
| PubChem CID | 134591466 |
| Molecular Formula | C33H49FN4 |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | N-[3-(2-cyclohexylethyl)-7,7-dimethyloctyl]-1-[5-(3-ethyl-2-fluorophenyl)pyrimidin-2-yl]azetidin-3-imine |
| SMILES | CCc1cccc(-c2cnc(N3CC(=NCCC(CCCC(C)(C)C)CCC4CCCCC4)C3)nc2)c1F |
| InChI | InChI=1S/C33H49FN4/c1-5-27-14-9-15-30(31(27)34)28-21-36-32(37-22-28)38-23-29(24-38)35-20-18-26(13-10-19-33(2,3)4)17-16-25-11-7-6-8-12-25/h9,14-15,21-22,25-26H,5-8,10-13,16-20,23-24H2,1-4H3 |
| InChIKey | AYJDSHVFBJWAMX-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|