C24H36F6O8 — CID 163958198
5-O-[2-[5,5-dimethyl-6-oxo-6-(1,1,1-trifluoropropan-2-yloxy)hexanoyl]oxyethyl] 1-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2-methylpentanedioate (PubChem CID 163958198) has the molecular formula C24H36F6O8 and a molecular weight of 566.53 g/mol. Its IUPAC name is 5-O-[2-[5,5-dimethyl-6-oxo-6-(1,1,1-trifluoropropan-2-yloxy)hexanoyl]oxyethyl] 1-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2-methylpentanedioate.
| Compound Name | 5-O-[2-[5,5-dimethyl-6-oxo-6-(1,1,1-trifluoropropan-2-yloxy)hexanoyl]oxyethyl] 1-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2-methylpentanedioate |
|---|---|
| PubChem CID | 163958198 |
| Molecular Formula | C24H36F6O8 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 5-O-[2-[5,5-dimethyl-6-oxo-6-(1,1,1-trifluoropropan-2-yloxy)hexanoyl]oxyethyl] 1-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2-methylpentanedioate |
| SMILES | CCC(C)(CCC(=O)OCCOC(=O)CCCC(C)(C)C(=O)OC(C)C(F)(F)F)C(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C24H36F6O8/c1-7-22(6,20(34)38-16(3)24(28,29)30)12-10-18(32)36-14-13-35-17(31)9-8-11-21(4,5)19(33)37-15(2)23(25,26)27/h15-16H,7-14H2,1-6H3 |
| InChIKey | JUOSXYFLSALVBB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|