C20H23FN2O2 — CID 163958592
6-ethyl-3-ethynyl-7-fluoro-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-quinolin-2-one (PubChem CID 163958592) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 6-ethyl-3-ethynyl-7-fluoro-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-quinolin-2-one.
| Compound Name | 6-ethyl-3-ethynyl-7-fluoro-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 163958592 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 6-ethyl-3-ethynyl-7-fluoro-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-quinolin-2-one |
| SMILES | C#Cc1c(N2CCC(C)(OC)CC2)c2cc(CC)c(F)cc2[nH]c1=O |
| InChI | InChI=1S/C20H23FN2O2/c1-5-13-11-15-17(12-16(13)21)22-19(24)14(6-2)18(15)23-9-7-20(3,25-4)8-10-23/h2,11-12H,5,7-10H2,1,3-4H3,(H,22,24) |
| InChIKey | NAHMCVAJUIQLEC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|