C22H26N2O2 — CID 163958594
3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-6-[(1S,2R)-2-methylcyclopropyl]-1H-quinolin-2-one (PubChem CID 163958594) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-6-[(1S,2R)-2-methylcyclopropyl]-1H-quinolin-2-one.
| Compound Name | 3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-6-[(1S,2R)-2-methylcyclopropyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 163958594 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-6-[(1S,2R)-2-methylcyclopropyl]-1H-quinolin-2-one |
| SMILES | C#Cc1c(N2CCC(C)(OC)CC2)c2cc([C@H]3C[C@H]3C)ccc2[nH]c1=O |
| InChI | InChI=1S/C22H26N2O2/c1-5-16-20(24-10-8-22(3,26-4)9-11-24)18-13-15(17-12-14(17)2)6-7-19(18)23-21(16)25/h1,6-7,13-14,17H,8-12H2,2-4H3,(H,23,25)/t14-,17+/m1/s1 |
| InChIKey | OIZFDFPJSPGGIJ-PBHICJAKSA-N |
| XLogP | 3.64 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|