C20H23N3O2 — CID 164959338
6-cyclopropyl-3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-1,5-naphthyridin-2-one (PubChem CID 164959338) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6-cyclopropyl-3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-1,5-naphthyridin-2-one.
| Compound Name | 6-cyclopropyl-3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 164959338 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 6-cyclopropyl-3-ethynyl-4-(4-methoxy-4-methylpiperidin-1-yl)-1H-1,5-naphthyridin-2-one |
| SMILES | C#Cc1c(N2CCC(C)(OC)CC2)c2nc(C3CC3)ccc2[nH]c1=O |
| InChI | InChI=1S/C20H23N3O2/c1-4-14-18(23-11-9-20(2,25-3)10-12-23)17-16(22-19(14)24)8-7-15(21-17)13-5-6-13/h1,7-8,13H,5-6,9-12H2,2-3H3,(H,22,24) |
| InChIKey | FGOZQWVZXFFATH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|