About 1-methyl-2-oxido-1,2-dipropylhydrazine
1-methyl-2-oxido-1,2-dipropylhydrazine (PubChem CID 163958911) has the molecular formula C7H17N2O-
and a molecular weight of 145.23 g/mol. Its IUPAC name is 1-methyl-2-oxido-1,2-dipropylhydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-oxido-1,2-dipropylhydrazine |
| PubChem CID | 163958911 |
| Molecular Formula | C7H17N2O- |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 1-methyl-2-oxido-1,2-dipropylhydrazine |
| SMILES | CCCN(C)N([O-])CCC |
| InChI | InChI=1S/C7H17N2O/c1-4-6-8(3)9(10)7-5-2/h4-7H2,1-3H3/q-1 |
| InChIKey | TZVOQRYPEUVSNM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-oxido-1,2-dipropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-oxido-1,2-dipropylhydrazine?
The IUPAC name of 1-methyl-2-oxido-1,2-dipropylhydrazine (CID 163958911) is 1-methyl-2-oxido-1,2-dipropylhydrazine.
What is the SMILES notation for 1-methyl-2-oxido-1,2-dipropylhydrazine?
The canonical SMILES for 1-methyl-2-oxido-1,2-dipropylhydrazine is CCCN(C)N([O-])CCC.
What is the InChIKey of 1-methyl-2-oxido-1,2-dipropylhydrazine?
The InChIKey is TZVOQRYPEUVSNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N2O/c1-4-6-8(3)9(10)7-5-2/h4-7H2,1-3H3/q-1.
What are the key properties of 1-methyl-2-oxido-1,2-dipropylhydrazine?
1-methyl-2-oxido-1,2-dipropylhydrazine has a molecular weight of 145.23 g/mol, XLogP of 1.45, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-oxido-1,2-dipropylhydrazine is sourced from PubChem (CID 163958911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).