C32H33N7O — CID 163959409
(11R,15S)-5-(N-ethylanilino)-8-methyl-4-[[4-(5-methyl-2-pyridinyl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 163959409) has the molecular formula C32H33N7O and a molecular weight of 531.66 g/mol. Its IUPAC name is (11R,15S)-5-(N-ethylanilino)-8-methyl-4-[[4-(5-methyl-2-pyridinyl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-(N-ethylanilino)-8-methyl-4-[[4-(5-methyl-2-pyridinyl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 163959409 |
| Molecular Formula | C32H33N7O |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | (11R,15S)-5-(N-ethylanilino)-8-methyl-4-[[4-(5-methyl-2-pyridinyl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CCN(c1ccccc1)c1c2c(nn1Cc1ccc(-c3ccc(C)cn3)cc1)N1C(=N[C@@H]3CCC[C@@H]31)N(C)C2=O |
| InChI | InChI=1S/C32H33N7O/c1-4-37(24-9-6-5-7-10-24)30-28-29(39-27-12-8-11-26(27)34-32(39)36(3)31(28)40)35-38(30)20-22-14-16-23(17-15-22)25-18-13-21(2)19-33-25/h5-7,9-10,13-19,26-27H,4,8,11-12,20H2,1-3H3/t26-,27+/m1/s1 |
| InChIKey | SGFCWDAYAUGNEA-SXOMAYOGSA-N |
| XLogP | 5.64 |
| TPSA | 69.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |