C27H27F2N5OS — CID 58456650
4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one (PubChem CID 58456650) has the molecular formula C27H27F2N5OS and a molecular weight of 507.61 g/mol. Its IUPAC name is 4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one.
| Compound Name | 4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 58456650 |
| Molecular Formula | C27H27F2N5OS |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(C(C)(F)F)cc3)c2Sc2ccccc2)N2C1=NC1CCCCC12 |
| InChI | InChI=1S/C27H27F2N5OS/c1-27(28,29)18-14-12-17(13-15-18)16-33-25(36-19-8-4-3-5-9-19)22-23(31-33)34-21-11-7-6-10-20(21)30-26(34)32(2)24(22)35/h3-5,8-9,12-15,20-21H,6-7,10-11,16H2,1-2H3 |
| InChIKey | CHJAKKVBPYTWLC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |