C30H29FN6OS — CID 129194470
4-[[4-[(1Z,3Z)-5-fluoro-1-(methylideneamino)penta-1,3-dienyl]phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 129194470) has the molecular formula C30H29FN6OS and a molecular weight of 540.67 g/mol. Its IUPAC name is 4-[[4-[(1Z,3Z)-5-fluoro-1-(methylideneamino)penta-1,3-dienyl]phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | 4-[[4-[(1Z,3Z)-5-fluoro-1-(methylideneamino)penta-1,3-dienyl]phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 129194470 |
| Molecular Formula | C30H29FN6OS |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 4-[[4-[(1Z,3Z)-5-fluoro-1-(methylideneamino)penta-1,3-dienyl]phenyl]methyl]-8-methyl-5-phenylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | C=N/C(=C\C=C/CF)c1ccc(Cn2nc3c(c2Sc2ccccc2)C(=O)N(C)C2=NC4CCCC4N23)cc1 |
| InChI | InChI=1S/C30H29FN6OS/c1-32-23(11-6-7-18-31)21-16-14-20(15-17-21)19-36-29(39-22-9-4-3-5-10-22)26-27(34-36)37-25-13-8-12-24(25)33-30(37)35(2)28(26)38/h3-7,9-11,14-17,24-25H,1,8,12-13,18-19H2,2H3/b7-6-,23-11- |
| InChIKey | FPIBIEZMINADNK-LAFBOLATSA-N |
| XLogP | 5.83 |
| TPSA | 66.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|