C24H21F3N6OS — CID 46238865
(11R,15S)-8-methyl-5-phenylsulfanyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 46238865) has the molecular formula C24H21F3N6OS and a molecular weight of 498.53 g/mol. Its IUPAC name is (11R,15S)-8-methyl-5-phenylsulfanyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-8-methyl-5-phenylsulfanyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 46238865 |
| Molecular Formula | C24H21F3N6OS |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (11R,15S)-8-methyl-5-phenylsulfanyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(C(F)(F)F)nc3)c2Sc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C24H21F3N6OS/c1-31-21(34)19-20(33-17-9-5-8-16(17)29-23(31)33)30-32(22(19)35-15-6-3-2-4-7-15)13-14-10-11-18(28-12-14)24(25,26)27/h2-4,6-7,10-12,16-17H,5,8-9,13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | VZCMWVCGKMQRSW-SJORKVTESA-N |
| XLogP | 4.68 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |