C33H33ClN2O10 — CID 163962656
1-O-tert-butyl 2-O-[2-[4-[6-chloro-4-(2-hydroxyacetyl)-2-nitro-3-phenylmethoxyphenyl]phenyl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 163962656) has the molecular formula C33H33ClN2O10 and a molecular weight of 653.08 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[2-[4-[6-chloro-4-(2-hydroxyacetyl)-2-nitro-3-phenylmethoxyphenyl]phenyl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[2-[4-[6-chloro-4-(2-hydroxyacetyl)-2-nitro-3-phenylmethoxyphenyl]phenyl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163962656 |
| Molecular Formula | C33H33ClN2O10 |
| Molecular Weight | 653.08 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-[2-[4-[6-chloro-4-(2-hydroxyacetyl)-2-nitro-3-phenylmethoxyphenyl]phenyl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCC(=O)c1ccc(-c2c(Cl)cc(C(=O)CO)c(OCc3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H33ClN2O10/c1-33(2,3)46-32(41)35-15-7-10-25(35)31(40)45-19-27(39)21-11-13-22(14-12-21)28-24(34)16-23(26(38)17-37)30(29(28)36(42)43)44-18-20-8-5-4-6-9-20/h4-6,8-9,11-14,16,25,37H,7,10,15,17-19H2,1-3H3/t25-/m0/s1 |
| InChIKey | SIWPXVLLRNBYAY-VWLOTQADSA-N |
| XLogP | 5.79 |
| TPSA | 162.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.08 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|