C29H39FN6O9 — CID 163964082
[4-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]phenyl]methyl N-[1-[(2R,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate (PubChem CID 163964082) has the molecular formula C29H39FN6O9 and a molecular weight of 634.66 g/mol. Its IUPAC name is [4-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]phenyl]methyl N-[1-[(2R,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | [4-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]phenyl]methyl N-[1-[(2R,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 163964082 |
| Molecular Formula | C29H39FN6O9 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | [4-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]phenyl]methyl N-[1-[(2R,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(=O)Nc1ccc(COC(=O)Nc2nc(=O)n([C@@H]3O[C@H](C)C(O)[C@@H]3O)cc2F)cc1 |
| InChI | InChI=1S/C29H39FN6O9/c1-3-4-5-6-7-8-22(38)33-20(13-21(31)37)26(41)32-18-11-9-17(10-12-18)15-44-29(43)35-25-19(30)14-36(28(42)34-25)27-24(40)23(39)16(2)45-27/h9-12,14,16,20,23-24,27,39-40H,3-8,13,15H2,1-2H3,(H2,31,37)(H,32,41)(H,33,38)(H,34,35,42,43)/t16-,20-,23?,24+,27-/m1/s1 |
| InChIKey | SKCHXRFLSNDWJC-MQHVRGAFSA-N |
| XLogP | 1.43 |
| TPSA | 224.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|