C26H33FN4O8 — CID 159717375
benzyl N-[1-[[1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino]-1,8-dioxononan-2-yl]carbamate (PubChem CID 159717375) has the molecular formula C26H33FN4O8 and a molecular weight of 548.57 g/mol. Its IUPAC name is benzyl N-[1-[[1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino]-1,8-dioxononan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino]-1,8-dioxononan-2-yl]carbamate |
|---|---|
| PubChem CID | 159717375 |
| Molecular Formula | C26H33FN4O8 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | benzyl N-[1-[[1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino]-1,8-dioxononan-2-yl]carbamate |
| SMILES | CC(=O)CCCCCC(NC(=O)OCc1ccccc1)C(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@H](O)C2O)cc1F |
| InChI | InChI=1S/C26H33FN4O8/c1-15(32)9-5-3-8-12-19(28-26(37)38-14-17-10-6-4-7-11-17)23(35)29-22-18(27)13-31(25(36)30-22)24-21(34)20(33)16(2)39-24/h4,6-7,10-11,13,16,19-21,24,33-34H,3,5,8-9,12,14H2,1-2H3,(H,28,37)(H,29,30,35,36)/t16-,19?,20+,21?,24-/m1/s1 |
| InChIKey | MBKCKSPCPRLBHN-NBFSZILRSA-N |
| XLogP | 1.79 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|