C50H92FN3O6 — CID 59005324
[(9R,15R)-3-[(8R)-3-ethyl-7,8-dimethylundecyl]-6,9,10,15,16-pentamethylicosyl] N-[1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate (PubChem CID 59005324) has the molecular formula C50H92FN3O6 and a molecular weight of 850.30 g/mol. Its IUPAC name is [(9R,15R)-3-[(8R)-3-ethyl-7,8-dimethylundecyl]-6,9,10,15,16-pentamethylicosyl] N-[1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | [(9R,15R)-3-[(8R)-3-ethyl-7,8-dimethylundecyl]-6,9,10,15,16-pentamethylicosyl] N-[1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 59005324 |
| Molecular Formula | C50H92FN3O6 |
| Molecular Weight | 850.30 g/mol |
| Exact Mass | 849.70 |
| IUPAC Name | [(9R,15R)-3-[(8R)-3-ethyl-7,8-dimethylundecyl]-6,9,10,15,16-pentamethylicosyl] N-[1-(3,4-dihydroxy-5-methyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCC(C)[C@H](C)CCCCC(C)[C@H](C)CCC(C)CCC(CCOC(=O)Nc1nc(=O)n(C2OC(C)C(O)C2O)cc1F)CCC(CC)CCCC(C)[C@H](C)CCC |
| InChI | InChI=1S/C50H92FN3O6/c1-12-15-20-36(6)37(7)21-16-17-22-38(8)40(10)27-25-34(4)26-28-43(30-29-42(14-3)24-18-23-39(9)35(5)19-13-2)31-32-59-50(58)53-47-44(51)33-54(49(57)52-47)48-46(56)45(55)41(11)60-48/h33-43,45-46,48,55-56H,12-32H2,1-11H3,(H,52,53,57,58)/t34?,35-,36?,37-,38?,39?,40-,41?,42?,43?,45?,46?,48?/m1/s1 |
| InChIKey | FNJZZGXXVVOHID-ZFDKCUAXSA-N |
| XLogP | 13.12 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.30 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|