C15H23ClN2 — CID 163966358
5-chloro-2-methyl-6-[2-[(1S,6S)-6-methylcyclohex-3-en-1-yl]propyl]-1,2-dihydropyrimidine (PubChem CID 163966358) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 5-chloro-2-methyl-6-[2-[(1S,6S)-6-methylcyclohex-3-en-1-yl]propyl]-1,2-dihydropyrimidine.
| Compound Name | 5-chloro-2-methyl-6-[2-[(1S,6S)-6-methylcyclohex-3-en-1-yl]propyl]-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 163966358 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-chloro-2-methyl-6-[2-[(1S,6S)-6-methylcyclohex-3-en-1-yl]propyl]-1,2-dihydropyrimidine |
| SMILES | CC1N=CC(Cl)=C(CC(C)[C@H]2CC=CC[C@@H]2C)N1 |
| InChI | InChI=1S/C15H23ClN2/c1-10-6-4-5-7-13(10)11(2)8-15-14(16)9-17-12(3)18-15/h4-5,9-13,18H,6-8H2,1-3H3/t10-,11?,12?,13-/m0/s1 |
| InChIKey | SMDFNJBQQKFOIL-WTIISPKJSA-N |
| XLogP | 4.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|