C19H36N6O3 — CID 163966524
N-[5-[(2-azidoacetyl)amino]pentyl]-4-ethyl-N',N',2,2,4-pentamethylpentanediamide (PubChem CID 163966524) has the molecular formula C19H36N6O3 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[5-[(2-azidoacetyl)amino]pentyl]-4-ethyl-N',N',2,2,4-pentamethylpentanediamide.
| Compound Name | N-[5-[(2-azidoacetyl)amino]pentyl]-4-ethyl-N',N',2,2,4-pentamethylpentanediamide |
|---|---|
| PubChem CID | 163966524 |
| Molecular Formula | C19H36N6O3 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | N-[5-[(2-azidoacetyl)amino]pentyl]-4-ethyl-N',N',2,2,4-pentamethylpentanediamide |
| SMILES | CCC(C)(CC(C)(C)C(=O)NCCCCCNC(=O)CN=[N+]=[N-])C(=O)N(C)C |
| InChI | InChI=1S/C19H36N6O3/c1-7-19(4,17(28)25(5)6)14-18(2,3)16(27)22-12-10-8-9-11-21-15(26)13-23-24-20/h7-14H2,1-6H3,(H,21,26)(H,22,27) |
| InChIKey | SMGRDVOFUINPOK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 127.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|