C26H48GaIN7O5 — CID 140772079
CID 140772079 (PubChem CID 140772079) has the molecular formula C26H48GaIN7O5 and a molecular weight of 735.34 g/mol.
| Compound Name | CID 140772079 |
|---|---|
| PubChem CID | 140772079 |
| Molecular Formula | C26H48GaIN7O5 |
| Molecular Weight | 735.34 g/mol |
| Exact Mass | 734.20 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)NCCCCCC(=O)N[Ga]I)C(=O)NCCCN=[N+]=[N-])C(=O)NCC(C)O |
| InChI | InChI=1S/C26H49N7O5.Ga.HI/c1-7-25(5,22(37)31-16-19(2)34)18-26(6,23(38)30-14-11-15-32-33-28)17-24(3,4)21(36)29-13-10-8-9-12-20(27)35;;/h19,34H,7-18H2,1-6H3,(H5,27,29,30,31,35,36,37,38);;1H/q;+2;/p-2 |
| InChIKey | TVCYGBSUAXAZKG-UHFFFAOYSA-L |
| XLogP | 3.29 |
| TPSA | 185.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|