C25H39N3O7 — CID 59930686
(4-nitrophenyl) 6-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]hexanoate (PubChem CID 59930686) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is (4-nitrophenyl) 6-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]hexanoate.
| Compound Name | (4-nitrophenyl) 6-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 59930686 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (4-nitrophenyl) 6-[[4-(2-hydroxypropylcarbamoyl)-2,2,4-trimethylhexanoyl]amino]hexanoate |
| SMILES | CCC(C)(CC(C)(C)C(=O)NCCCCCC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)NCC(C)O |
| InChI | InChI=1S/C25H39N3O7/c1-6-25(5,23(32)27-16-18(2)29)17-24(3,4)22(31)26-15-9-7-8-10-21(30)35-20-13-11-19(12-14-20)28(33)34/h11-14,18,29H,6-10,15-17H2,1-5H3,(H,26,31)(H,27,32) |
| InChIKey | JBRFGTLWXRDPGJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|