C13H23N7O5 — CID 155318155
tert-butyl N-[2-[[2-[2-[(2-azidoacetyl)amino]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 155318155) has the molecular formula C13H23N7O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[2-[(2-azidoacetyl)amino]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[2-[(2-azidoacetyl)amino]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 155318155 |
| Molecular Formula | C13H23N7O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | tert-butyl N-[2-[[2-[2-[(2-azidoacetyl)amino]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NCCNC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C13H23N7O5/c1-13(2,3)25-12(24)18-7-10(22)17-6-9(21)15-4-5-16-11(23)8-19-20-14/h4-8H2,1-3H3,(H,15,21)(H,16,23)(H,17,22)(H,18,24) |
| InChIKey | KWBJJIOOQUFVFV-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 174.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|