C9H15FN4O2 — CID 154734307
tert-butyl N-[(Z)-4-azido-3-fluorobut-2-enyl]carbamate (PubChem CID 154734307) has the molecular formula C9H15FN4O2 and a molecular weight of 230.24 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4-azido-3-fluorobut-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-4-azido-3-fluorobut-2-enyl]carbamate |
|---|---|
| PubChem CID | 154734307 |
| Molecular Formula | C9H15FN4O2 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | tert-butyl N-[(Z)-4-azido-3-fluorobut-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C(\F)CN=[N+]=[N-] |
| InChI | InChI=1S/C9H15FN4O2/c1-9(2,3)16-8(15)12-5-4-7(10)6-13-14-11/h4H,5-6H2,1-3H3,(H,12,15)/b7-4- |
| InChIKey | KTTSCPHZMIIPLM-DAXSKMNVSA-N |
| XLogP | 2.67 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|