C16H10O3 — CID 163968323
12-methoxy-4-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5,7,9(16),10(15),11,13-heptaen-3-one (PubChem CID 163968323) has the molecular formula C16H10O3 and a molecular weight of 250.25 g/mol. Its IUPAC name is 12-methoxy-4-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5,7,9(16),10(15),11,13-heptaen-3-one.
| Compound Name | 12-methoxy-4-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5,7,9(16),10(15),11,13-heptaen-3-one |
|---|---|
| PubChem CID | 163968323 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 12-methoxy-4-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,5,7,9(16),10(15),11,13-heptaen-3-one |
| SMILES | COc1ccc2c(c1)-c1cccc3oc(=O)cc-2c13 |
| InChI | InChI=1S/C16H10O3/c1-18-9-5-6-10-12(7-9)11-3-2-4-14-16(11)13(10)8-15(17)19-14/h2-8H,1H3 |
| InChIKey | SNUIFVHZLHHZNZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|