C20H21F4MnNOP- — CID 163970796
N-benzyl-4-[(3S)-3-fluoro-3-phosphanylbutan-2-yl]-N-(2,2,2-trifluoroethyl)benzamide;manganese (PubChem CID 163970796) has the molecular formula C20H21F4MnNOP- and a molecular weight of 453.30 g/mol. Its IUPAC name is N-benzyl-4-[(3S)-3-fluoro-3-phosphanylbutan-2-yl]-N-(2,2,2-trifluoroethyl)benzamide;manganese.
| Compound Name | N-benzyl-4-[(3S)-3-fluoro-3-phosphanylbutan-2-yl]-N-(2,2,2-trifluoroethyl)benzamide;manganese |
|---|---|
| PubChem CID | 163970796 |
| Molecular Formula | C20H21F4MnNOP- |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-benzyl-4-[(3S)-3-fluoro-3-phosphanylbutan-2-yl]-N-(2,2,2-trifluoroethyl)benzamide;manganese |
| SMILES | C[C-](c1ccc(C(=O)N(Cc2ccccc2)CC(F)(F)F)cc1)[C@@](C)(F)P.[Mn] |
| InChI | InChI=1S/C20H21F4NOP.Mn/c1-14(19(2,21)27)16-8-10-17(11-9-16)18(26)25(13-20(22,23)24)12-15-6-4-3-5-7-15;/h3-11H,12-13,27H2,1-2H3;/q-1;/t19-;/m0./s1 |
| InChIKey | ICJQKZWJTUPCMC-FYZYNONXSA-N |
| XLogP | 5.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|