C7H11F2N — CID 163971429
(4,6-difluorocyclohexen-1-yl)methanamine (PubChem CID 163971429) has the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. Its IUPAC name is (4,6-difluorocyclohexen-1-yl)methanamine.
| Compound Name | (4,6-difluorocyclohexen-1-yl)methanamine |
|---|---|
| PubChem CID | 163971429 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (4,6-difluorocyclohexen-1-yl)methanamine |
| SMILES | NCC1=CCC(F)CC1F |
| InChI | InChI=1S/C7H11F2N/c8-6-2-1-5(4-10)7(9)3-6/h1,6-7H,2-4,10H2 |
| InChIKey | SQHWQZYSRUYYIO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|