C11H23NS — CID 163971973
4-[(2R)-1-methylsulfanylpropan-2-yl]hept-5-en-1-amine (PubChem CID 163971973) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is 4-[(2R)-1-methylsulfanylpropan-2-yl]hept-5-en-1-amine.
| Compound Name | 4-[(2R)-1-methylsulfanylpropan-2-yl]hept-5-en-1-amine |
|---|---|
| PubChem CID | 163971973 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 4-[(2R)-1-methylsulfanylpropan-2-yl]hept-5-en-1-amine |
| SMILES | CC=CC(CCCN)[C@@H](C)CSC |
| InChI | InChI=1S/C11H23NS/c1-4-6-11(7-5-8-12)10(2)9-13-3/h4,6,10-11H,5,7-9,12H2,1-3H3/t10-,11?/m0/s1 |
| InChIKey | HZAFOIRJRBSEMY-VUWPPUDQSA-N |
| XLogP | 2.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|