C29H34N2P2 — CID 163974789
N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N'-diphenylphosphanyl-N,N-dimethylpropane-1,3-diamine (PubChem CID 163974789) has the molecular formula C29H34N2P2 and a molecular weight of 472.55 g/mol. Its IUPAC name is N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N'-diphenylphosphanyl-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N'-diphenylphosphanyl-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 163974789 |
| Molecular Formula | C29H34N2P2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N'-diphenylphosphanyl-N,N-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(P(C1=CCCC=C1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34N2P2/c1-30(2)24-15-25-31(32(26-16-7-3-8-17-26)27-18-9-4-10-19-27)33(28-20-11-5-12-21-28)29-22-13-6-14-23-29/h3-5,7-13,16-23H,6,14-15,24-25H2,1-2H3 |
| InChIKey | STDYMUJNTIUUGR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|