C14H18ClP — CID 143889847
chloro-cyclohexa-1,5-dien-1-yl-phenylphosphane;ethane (PubChem CID 143889847) has the molecular formula C14H18ClP and a molecular weight of 252.73 g/mol. Its IUPAC name is chloro-cyclohexa-1,5-dien-1-yl-phenylphosphane;ethane.
| Compound Name | chloro-cyclohexa-1,5-dien-1-yl-phenylphosphane;ethane |
|---|---|
| PubChem CID | 143889847 |
| Molecular Formula | C14H18ClP |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | chloro-cyclohexa-1,5-dien-1-yl-phenylphosphane;ethane |
| SMILES | CC.ClP(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C12H12ClP.C2H6/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1,3-5,7-10H,2,6H2;1-2H3 |
| InChIKey | NIBZADJQGBINRF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|