C15H19OP — CID 170752667
3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]propan-1-ol (PubChem CID 170752667) has the molecular formula C15H19OP and a molecular weight of 246.29 g/mol. Its IUPAC name is 3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]propan-1-ol.
| Compound Name | 3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]propan-1-ol |
|---|---|
| PubChem CID | 170752667 |
| Molecular Formula | C15H19OP |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]propan-1-ol |
| SMILES | OCCCP(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C15H19OP/c16-12-7-13-17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1,3-5,8-11,16H,2,6-7,12-13H2 |
| InChIKey | NWYGSVLOPUZREH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|