C27H45N5O3 — CID 163976973
3-[[[1-ethyl-5-[(1R)-1-(ethylamino)ethyl]-3-methyl-2-(1-morpholin-4-ylethyl)-4H-pyridin-4-yl]oxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 163976973) has the molecular formula C27H45N5O3 and a molecular weight of 487.69 g/mol. Its IUPAC name is 3-[[[1-ethyl-5-[(1R)-1-(ethylamino)ethyl]-3-methyl-2-(1-morpholin-4-ylethyl)-4H-pyridin-4-yl]oxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-[[[1-ethyl-5-[(1R)-1-(ethylamino)ethyl]-3-methyl-2-(1-morpholin-4-ylethyl)-4H-pyridin-4-yl]oxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 163976973 |
| Molecular Formula | C27H45N5O3 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | 3-[[[1-ethyl-5-[(1R)-1-(ethylamino)ethyl]-3-methyl-2-(1-morpholin-4-ylethyl)-4H-pyridin-4-yl]oxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | CCN[C@H](C)C1=CN(CC)C(C(C)N2CCOCC2)=C(C)C1OCNCc1c(C)cc(C)[nH]c1=O |
| InChI | InChI=1S/C27H45N5O3/c1-8-29-21(6)24-16-31(9-2)25(22(7)32-10-12-34-13-11-32)20(5)26(24)35-17-28-15-23-18(3)14-19(4)30-27(23)33/h14,16,21-22,26,28-29H,8-13,15,17H2,1-7H3,(H,30,33)/t21-,22?,26?/m1/s1 |
| InChIKey | SVADNRNUGRSSHN-AGHUKTAOSA-N |
| XLogP | 2.64 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|