C7H7FN2O3 — CID 163977237
3-[5-(fluoromethyl)-1H-pyrazol-4-yl]-3-oxopropanoic acid (PubChem CID 163977237) has the molecular formula C7H7FN2O3 and a molecular weight of 186.14 g/mol. Its IUPAC name is 3-[5-(fluoromethyl)-1H-pyrazol-4-yl]-3-oxopropanoic acid.
| Compound Name | 3-[5-(fluoromethyl)-1H-pyrazol-4-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 163977237 |
| Molecular Formula | C7H7FN2O3 |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 3-[5-(fluoromethyl)-1H-pyrazol-4-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)c1cn[nH]c1CF |
| InChI | InChI=1S/C7H7FN2O3/c8-2-5-4(3-9-10-5)6(11)1-7(12)13/h3H,1-2H2,(H,9,10)(H,12,13) |
| InChIKey | SVFWCFLCFBYAIE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|