C8H11FN2O2 — CID 83817535
3-fluoro-3-(5-methyl-1H-pyrazol-4-yl)butanoic acid (PubChem CID 83817535) has the molecular formula C8H11FN2O2 and a molecular weight of 186.19 g/mol. Its IUPAC name is 3-fluoro-3-(5-methyl-1H-pyrazol-4-yl)butanoic acid.
| Compound Name | 3-fluoro-3-(5-methyl-1H-pyrazol-4-yl)butanoic acid |
|---|---|
| PubChem CID | 83817535 |
| Molecular Formula | C8H11FN2O2 |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-fluoro-3-(5-methyl-1H-pyrazol-4-yl)butanoic acid |
| SMILES | Cc1[nH]ncc1C(C)(F)CC(=O)O |
| InChI | InChI=1S/C8H11FN2O2/c1-5-6(4-10-11-5)8(2,9)3-7(12)13/h4H,3H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | MRBJATYUYMOGLB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |