C19H27F3NO3S2+ — CID 163978862
1-(4-hexylphenyl)-2-[4-(trifluoromethylsulfonyl)thiomorpholin-1-ium-1-yl]ethanone (PubChem CID 163978862) has the molecular formula C19H27F3NO3S2+ and a molecular weight of 438.56 g/mol. Its IUPAC name is 1-(4-hexylphenyl)-2-[4-(trifluoromethylsulfonyl)thiomorpholin-1-ium-1-yl]ethanone.
| Compound Name | 1-(4-hexylphenyl)-2-[4-(trifluoromethylsulfonyl)thiomorpholin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 163978862 |
| Molecular Formula | C19H27F3NO3S2+ |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-(4-hexylphenyl)-2-[4-(trifluoromethylsulfonyl)thiomorpholin-1-ium-1-yl]ethanone |
| SMILES | CCCCCCc1ccc(C(=O)C[S+]2CCN(S(=O)(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H27F3NO3S2/c1-2-3-4-5-6-16-7-9-17(10-8-16)18(24)15-27-13-11-23(12-14-27)28(25,26)19(20,21)22/h7-10H,2-6,11-15H2,1H3/q+1 |
| InChIKey | SWOTZOHBVPXJSO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|