C34H47BrN2O6 — CID 163980694
tert-butyl 7-bromo-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate;2-O-tert-butyl 7-O-methyl 4,4-dimethyl-1,3-dihydroisoquinoline-2,7-dicarboxylate (PubChem CID 163980694) has the molecular formula C34H47BrN2O6 and a molecular weight of 659.66 g/mol. Its IUPAC name is tert-butyl 7-bromo-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate;2-O-tert-butyl 7-O-methyl 4,4-dimethyl-1,3-dihydroisoquinoline-2,7-dicarboxylate.
| Compound Name | tert-butyl 7-bromo-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate;2-O-tert-butyl 7-O-methyl 4,4-dimethyl-1,3-dihydroisoquinoline-2,7-dicarboxylate |
|---|---|
| PubChem CID | 163980694 |
| Molecular Formula | C34H47BrN2O6 |
| Molecular Weight | 659.66 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | tert-butyl 7-bromo-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate;2-O-tert-butyl 7-O-methyl 4,4-dimethyl-1,3-dihydroisoquinoline-2,7-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(Br)ccc2C(C)(C)C1.COC(=O)c1ccc2c(c1)CN(C(=O)OC(C)(C)C)CC2(C)C |
| InChI | InChI=1S/C18H25NO4.C16H22BrNO2/c1-17(2,3)23-16(21)19-10-13-9-12(15(20)22-6)7-8-14(13)18(4,5)11-19;1-15(2,3)20-14(19)18-9-11-8-12(17)6-7-13(11)16(4,5)10-18/h7-9H,10-11H2,1-6H3;6-8H,9-10H2,1-5H3 |
| InChIKey | SYCPHPMGQNODQS-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.66 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|