C8H13NO2S2 — CID 163983745
3-(3-sulfanylidenebutyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 163983745) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-(3-sulfanylidenebutyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(3-sulfanylidenebutyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 163983745 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 3-(3-sulfanylidenebutyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=S)CCN1CSCC1C(=O)O |
| InChI | InChI=1S/C8H13NO2S2/c1-6(12)2-3-9-5-13-4-7(9)8(10)11/h7H,2-5H2,1H3,(H,10,11) |
| InChIKey | TUMUNGLGARPTKC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|