C23H26ClN5O — CID 163984346
1-[(4-chlorophenyl)methyl]-3-[4-[(5-phenyltriazol-1-yl)methyl]cyclohexyl]urea (PubChem CID 163984346) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[(5-phenyltriazol-1-yl)methyl]cyclohexyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(5-phenyltriazol-1-yl)methyl]cyclohexyl]urea |
|---|---|
| PubChem CID | 163984346 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(5-phenyltriazol-1-yl)methyl]cyclohexyl]urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)NC1CCC(Cn2nncc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26ClN5O/c24-20-10-6-17(7-11-20)14-25-23(30)27-21-12-8-18(9-13-21)16-29-22(15-26-28-29)19-4-2-1-3-5-19/h1-7,10-11,15,18,21H,8-9,12-14,16H2,(H2,25,27,30) |
| InChIKey | TUYXSHNAONIEKI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |