C41H32N2O2 — CID 163984472
[9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylcyclohexa-1,5-dien-1-yl]carbazol-3-yl] prop-2-enoate (PubChem CID 163984472) has the molecular formula C41H32N2O2 and a molecular weight of 584.72 g/mol. Its IUPAC name is [9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylcyclohexa-1,5-dien-1-yl]carbazol-3-yl] prop-2-enoate.
| Compound Name | [9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylcyclohexa-1,5-dien-1-yl]carbazol-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 163984472 |
| Molecular Formula | C41H32N2O2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | [9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylcyclohexa-1,5-dien-1-yl]carbazol-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc2c(c1)c1ccccc1n2C1=CC(C)C(c2ccc(-n3c4ccccc4c4ccccc43)cc2C)C=C1 |
| InChI | InChI=1S/C41H32N2O2/c1-4-41(44)45-30-19-22-40-36(25-30)35-13-7-10-16-39(35)43(40)29-18-21-32(27(3)24-29)31-20-17-28(23-26(31)2)42-37-14-8-5-11-33(37)34-12-6-9-15-38(34)42/h4-25,27,32H,1H2,2-3H3 |
| InChIKey | TVBKXOCSIZHQKR-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|