C27H30ClN3O4 — CID 163985590
N-[(2S,4S)-5-amino-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]-4-(4-chlorophenyl)-N-methylbenzamide (PubChem CID 163985590) has the molecular formula C27H30ClN3O4 and a molecular weight of 496.01 g/mol. Its IUPAC name is N-[(2S,4S)-5-amino-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]-4-(4-chlorophenyl)-N-methylbenzamide.
| Compound Name | N-[(2S,4S)-5-amino-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]-4-(4-chlorophenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 163985590 |
| Molecular Formula | C27H30ClN3O4 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[(2S,4S)-5-amino-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]-4-(4-chlorophenyl)-N-methylbenzamide |
| SMILES | COCOC[C@H](C[C@H](Cc1cccnc1)C(N)=O)N(C)C(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H30ClN3O4/c1-31(27(33)22-7-5-20(6-8-22)21-9-11-24(28)12-10-21)25(17-35-18-34-2)15-23(26(29)32)14-19-4-3-13-30-16-19/h3-13,16,23,25H,14-15,17-18H2,1-2H3,(H2,29,32)/t23-,25-/m0/s1 |
| InChIKey | TWAFAOXPYJHLMW-ZCYQVOJMSA-N |
| XLogP | 4.20 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|