C28H30ClN3O5 — CID 90708878
4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]benzamide (PubChem CID 90708878) has the molecular formula C28H30ClN3O5 and a molecular weight of 524.02 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]benzamide.
| Compound Name | 4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 90708878 |
| Molecular Formula | C28H30ClN3O5 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-5-oxo-4-(pyridin-3-ylmethyl)pentan-2-yl]benzamide |
| SMILES | COCOC[C@H](C[C@H](Cc1cccnc1)C(=O)NO)NC(=O)c1ccc(C=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H30ClN3O5/c1-36-19-37-18-26(16-24(28(34)32-35)15-22-3-2-14-30-17-22)31-27(33)23-10-6-20(7-11-23)4-5-21-8-12-25(29)13-9-21/h2-14,17,24,26,35H,15-16,18-19H2,1H3,(H,31,33)(H,32,34)/t24-,26-/m0/s1 |
| InChIKey | PIFVXWMVGSMKPO-AHWVRZQESA-N |
| XLogP | 4.38 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|