C22H28N2O5 — CID 18468557
N-[4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]benzamide (PubChem CID 18468557) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]benzamide.
| Compound Name | N-[4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 18468557 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]benzamide |
| SMILES | CCOCOCC(CC(Cc1ccccc1)C(=O)NO)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O5/c1-2-28-16-29-15-20(23-21(25)18-11-7-4-8-12-18)14-19(22(26)24-27)13-17-9-5-3-6-10-17/h3-12,19-20,27H,2,13-16H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | HIPXPEOMFJFZRG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|