C24H27N3O7S — CID 22094030
N-[4-(1-benzothiophen-3-ylmethyl)-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide (PubChem CID 22094030) has the molecular formula C24H27N3O7S and a molecular weight of 501.56 g/mol. Its IUPAC name is N-[4-(1-benzothiophen-3-ylmethyl)-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[4-(1-benzothiophen-3-ylmethyl)-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 22094030 |
| Molecular Formula | C24H27N3O7S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N-[4-(1-benzothiophen-3-ylmethyl)-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide |
| SMILES | CCOCOCC(CC(Cc1csc2ccccc12)C(=O)NO)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H27N3O7S/c1-2-33-15-34-13-19(25-23(28)16-7-9-20(10-8-16)27(31)32)12-17(24(29)26-30)11-18-14-35-22-6-4-3-5-21(18)22/h3-10,14,17,19,30H,2,11-13,15H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | QJEHSDVRBPYTRX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|