C16H23N3O8 — CID 22093732
N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-3-hydroxy-4-nitrobenzamide (PubChem CID 22093732) has the molecular formula C16H23N3O8 and a molecular weight of 385.37 g/mol. Its IUPAC name is N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-3-hydroxy-4-nitrobenzamide.
| Compound Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-3-hydroxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 22093732 |
| Molecular Formula | C16H23N3O8 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-3-hydroxy-4-nitrobenzamide |
| SMILES | CCOCOC[C@H](C[C@H](C)C(=O)NO)NC(=O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C16H23N3O8/c1-3-26-9-27-8-12(6-10(2)15(21)18-23)17-16(22)11-4-5-13(19(24)25)14(20)7-11/h4-5,7,10,12,20,23H,3,6,8-9H2,1-2H3,(H,17,22)(H,18,21)/t10-,12-/m0/s1 |
| InChIKey | HJVMDJBEAIAXFY-JQWIXIFHSA-N |
| XLogP | 0.94 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|