C22H28N2O5 — CID 142214641
N-[(2S,4S)-5-amino-1-(ethoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide (PubChem CID 142214641) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[(2S,4S)-5-amino-1-(ethoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide.
| Compound Name | N-[(2S,4S)-5-amino-1-(ethoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 142214641 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[(2S,4S)-5-amino-1-(ethoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide |
| SMILES | CCOCOC[C@H](C[C@H](C)C(N)=O)NC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N2O5/c1-3-27-15-28-14-18(13-16(2)21(23)25)24-22(26)17-9-11-20(12-10-17)29-19-7-5-4-6-8-19/h4-12,16,18H,3,13-15H2,1-2H3,(H2,23,25)(H,24,26)/t16-,18-/m0/s1 |
| InChIKey | JAZUKLGFTDPPIR-WMZOPIPTSA-N |
| XLogP | 3.10 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|