C26H36N2O7 — CID 86593853
N-[(2S,4S)-1-(ethoxymethoxy)-5-(2-methoxypropan-2-yloxyamino)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide (PubChem CID 86593853) has the molecular formula C26H36N2O7 and a molecular weight of 488.58 g/mol. Its IUPAC name is N-[(2S,4S)-1-(ethoxymethoxy)-5-(2-methoxypropan-2-yloxyamino)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide.
| Compound Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(2-methoxypropan-2-yloxyamino)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 86593853 |
| Molecular Formula | C26H36N2O7 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(2-methoxypropan-2-yloxyamino)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide |
| SMILES | CCOCOC[C@H](C[C@H](C)C(=O)NOC(C)(C)OC)NC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H36N2O7/c1-6-32-18-33-17-21(16-19(2)24(29)28-35-26(3,4)31-5)27-25(30)20-12-14-23(15-13-20)34-22-10-8-7-9-11-22/h7-15,19,21H,6,16-18H2,1-5H3,(H,27,30)(H,28,29)/t19-,21-/m0/s1 |
| InChIKey | YQBDFGQBMNKUAM-FPOVZHCZSA-N |
| XLogP | 4.04 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|