C16H23BrN2O5 — CID 22093737
4-bromo-N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]benzamide (PubChem CID 22093737) has the molecular formula C16H23BrN2O5 and a molecular weight of 403.27 g/mol. Its IUPAC name is 4-bromo-N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]benzamide.
| Compound Name | 4-bromo-N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 22093737 |
| Molecular Formula | C16H23BrN2O5 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-bromo-N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]benzamide |
| SMILES | CCOCOC[C@H](C[C@H](C)C(=O)NO)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H23BrN2O5/c1-3-23-10-24-9-14(8-11(2)15(20)19-22)18-16(21)12-4-6-13(17)7-5-12/h4-7,11,14,22H,3,8-10H2,1-2H3,(H,18,21)(H,19,20)/t11-,14-/m0/s1 |
| InChIKey | RHNKEZSSPKYKBU-FZMZJTMJSA-N |
| XLogP | 2.09 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|