C23H29BrN2O6 — CID 22093896
4-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]benzamide (PubChem CID 22093896) has the molecular formula C23H29BrN2O6 and a molecular weight of 509.40 g/mol. Its IUPAC name is 4-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]benzamide.
| Compound Name | 4-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 22093896 |
| Molecular Formula | C23H29BrN2O6 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 4-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]benzamide |
| SMILES | CCOCOCC(CC(Cc1cccc(OC)c1)C(=O)NO)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H29BrN2O6/c1-3-31-15-32-14-20(25-22(27)17-7-9-19(24)10-8-17)13-18(23(28)26-29)11-16-5-4-6-21(12-16)30-2/h4-10,12,18,20,29H,3,11,13-15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | IBDQFEOFGPEZCU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|