C21H27BrN2O6S — CID 22093930
5-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]thiophene-2-carboxamide (PubChem CID 22093930) has the molecular formula C21H27BrN2O6S and a molecular weight of 515.43 g/mol. Its IUPAC name is 5-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22093930 |
| Molecular Formula | C21H27BrN2O6S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 5-bromo-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-4-[(3-methoxyphenyl)methyl]-5-oxopentan-2-yl]thiophene-2-carboxamide |
| SMILES | CCOCOCC(CC(Cc1cccc(OC)c1)C(=O)NO)NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C21H27BrN2O6S/c1-3-29-13-30-12-16(23-21(26)18-7-8-19(22)31-18)11-15(20(25)24-27)9-14-5-4-6-17(10-14)28-2/h4-8,10,15-16,27H,3,9,11-13H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | YSFGRQWFCBFRRJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|