C19H25ClN2O6 — CID 20590873
4-chloro-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxo-4-(prop-2-ynoxymethyl)pentan-2-yl]benzamide (PubChem CID 20590873) has the molecular formula C19H25ClN2O6 and a molecular weight of 412.87 g/mol. Its IUPAC name is 4-chloro-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxo-4-(prop-2-ynoxymethyl)pentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxo-4-(prop-2-ynoxymethyl)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 20590873 |
| Molecular Formula | C19H25ClN2O6 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-chloro-N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxo-4-(prop-2-ynoxymethyl)pentan-2-yl]benzamide |
| SMILES | C#CCOCC(CC(COCOCC)NC(=O)c1ccc(Cl)cc1)C(=O)NO |
| InChI | InChI=1S/C19H25ClN2O6/c1-3-9-27-11-15(19(24)22-25)10-17(12-28-13-26-4-2)21-18(23)14-5-7-16(20)8-6-14/h1,5-8,15,17,25H,4,9-13H2,2H3,(H,21,23)(H,22,24) |
| InChIKey | PECKLQNPJYCNJK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|